C10H10ClNS — CID 18340659
6-chloro-2-propan-2-yl-1,3-benzothiazole (PubChem CID 18340659) has the molecular formula C10H10ClNS and a molecular weight of 211.72 g/mol. Its IUPAC name is 6-chloro-2-propan-2-yl-1,3-benzothiazole.
| Compound Name | 6-chloro-2-propan-2-yl-1,3-benzothiazole |
|---|---|
| PubChem CID | 18340659 |
| Molecular Formula | C10H10ClNS |
| Molecular Weight | 211.72 g/mol |
| Exact Mass | 211.02 |
| IUPAC Name | 6-chloro-2-propan-2-yl-1,3-benzothiazole |
| SMILES | CC(C)c1nc2ccc(Cl)cc2s1 |
| InChI | InChI=1S/C10H10ClNS/c1-6(2)10-12-8-4-3-7(11)5-9(8)13-10/h3-6H,1-2H3 |
| InChIKey | QNIJSWMZDPWJAA-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.72 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |