C10H11ClN2S2 — CID 119082887
N-[(5-chloro-1,3-benzothiazol-2-yl)sulfanyl]propan-2-amine (PubChem CID 119082887) has the molecular formula C10H11ClN2S2 and a molecular weight of 258.80 g/mol. Its IUPAC name is N-[(5-chloro-1,3-benzothiazol-2-yl)sulfanyl]propan-2-amine.
| Compound Name | N-[(5-chloro-1,3-benzothiazol-2-yl)sulfanyl]propan-2-amine |
|---|---|
| PubChem CID | 119082887 |
| Molecular Formula | C10H11ClN2S2 |
| Molecular Weight | 258.80 g/mol |
| Exact Mass | 258.01 |
| IUPAC Name | N-[(5-chloro-1,3-benzothiazol-2-yl)sulfanyl]propan-2-amine |
| SMILES | CC(C)NSc1nc2cc(Cl)ccc2s1 |
| InChI | InChI=1S/C10H11ClN2S2/c1-6(2)13-15-10-12-8-5-7(11)3-4-9(8)14-10/h3-6,13H,1-2H3 |
| InChIKey | OYHPTNRGTFYIAR-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.80 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|