C15H21ClN2S — CID 106027403
5-chloro-N-octan-4-yl-1,3-benzothiazol-2-amine (PubChem CID 106027403) has the molecular formula C15H21ClN2S and a molecular weight of 296.87 g/mol. Its IUPAC name is 5-chloro-N-octan-4-yl-1,3-benzothiazol-2-amine.
| Compound Name | 5-chloro-N-octan-4-yl-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 106027403 |
| Molecular Formula | C15H21ClN2S |
| Molecular Weight | 296.87 g/mol |
| Exact Mass | 296.11 |
| IUPAC Name | 5-chloro-N-octan-4-yl-1,3-benzothiazol-2-amine |
| SMILES | CCCCC(CCC)Nc1nc2cc(Cl)ccc2s1 |
| InChI | InChI=1S/C15H21ClN2S/c1-3-5-7-12(6-4-2)17-15-18-13-10-11(16)8-9-14(13)19-15/h8-10,12H,3-7H2,1-2H3,(H,17,18) |
| InChIKey | KJUCUHVEBWYVQV-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.87 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |