C16H10ClN3OS — CID 99578086
(2S)-2-(5-chloro-1,3-benzothiazol-2-yl)-2-cyano-N-phenylacetamide (PubChem CID 99578086) has the molecular formula C16H10ClN3OS and a molecular weight of 327.80 g/mol. Its IUPAC name is (2S)-2-(5-chloro-1,3-benzothiazol-2-yl)-2-cyano-N-phenylacetamide.
| Compound Name | (2S)-2-(5-chloro-1,3-benzothiazol-2-yl)-2-cyano-N-phenylacetamide |
|---|---|
| PubChem CID | 99578086 |
| Molecular Formula | C16H10ClN3OS |
| Molecular Weight | 327.80 g/mol |
| Exact Mass | 327.02 |
| IUPAC Name | (2S)-2-(5-chloro-1,3-benzothiazol-2-yl)-2-cyano-N-phenylacetamide |
| SMILES | N#C[C@@H](C(=O)Nc1ccccc1)c1nc2cc(Cl)ccc2s1 |
| InChI | InChI=1S/C16H10ClN3OS/c17-10-6-7-14-13(8-10)20-16(22-14)12(9-18)15(21)19-11-4-2-1-3-5-11/h1-8,12H,(H,19,21)/t12-/m0/s1 |
| InChIKey | GCNPAVRPUZZIEI-LBPRGKRZSA-N |
| XLogP | 4.20 |
| TPSA | 65.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.80 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |