C18H10Cl2N2OS — CID 76888138
2-(5-chloro-1,3-benzothiazol-2-yl)-5-(3-chlorophenyl)-3-oxopent-4-enenitrile (PubChem CID 76888138) has the molecular formula C18H10Cl2N2OS and a molecular weight of 373.26 g/mol. Its IUPAC name is 2-(5-chloro-1,3-benzothiazol-2-yl)-5-(3-chlorophenyl)-3-oxopent-4-enenitrile.
| Compound Name | 2-(5-chloro-1,3-benzothiazol-2-yl)-5-(3-chlorophenyl)-3-oxopent-4-enenitrile |
|---|---|
| PubChem CID | 76888138 |
| Molecular Formula | C18H10Cl2N2OS |
| Molecular Weight | 373.26 g/mol |
| Exact Mass | 371.99 |
| IUPAC Name | 2-(5-chloro-1,3-benzothiazol-2-yl)-5-(3-chlorophenyl)-3-oxopent-4-enenitrile |
| SMILES | N#CC(C(=O)C=Cc1cccc(Cl)c1)c1nc2cc(Cl)ccc2s1 |
| InChI | InChI=1S/C18H10Cl2N2OS/c19-12-3-1-2-11(8-12)4-6-16(23)14(10-21)18-22-15-9-13(20)5-7-17(15)24-18/h1-9,14H |
| InChIKey | GANUWWUDQCXZMF-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 53.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.26 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|