C17H12ClNO2S — CID 54289030
methyl 3-[2-(5-chloro-1,3-benzothiazol-2-yl)ethenyl]benzoate (PubChem CID 54289030) has the molecular formula C17H12ClNO2S and a molecular weight of 329.81 g/mol. Its IUPAC name is methyl 3-[2-(5-chloro-1,3-benzothiazol-2-yl)ethenyl]benzoate.
| Compound Name | methyl 3-[2-(5-chloro-1,3-benzothiazol-2-yl)ethenyl]benzoate |
|---|---|
| PubChem CID | 54289030 |
| Molecular Formula | C17H12ClNO2S |
| Molecular Weight | 329.81 g/mol |
| Exact Mass | 329.03 |
| IUPAC Name | methyl 3-[2-(5-chloro-1,3-benzothiazol-2-yl)ethenyl]benzoate |
| SMILES | COC(=O)c1cccc(C=Cc2nc3cc(Cl)ccc3s2)c1 |
| InChI | InChI=1S/C17H12ClNO2S/c1-21-17(20)12-4-2-3-11(9-12)5-8-16-19-14-10-13(18)6-7-15(14)22-16/h2-10H,1H3 |
| InChIKey | RWEWJQSTKZVYKY-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.81 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |