C16H13ClN2OS — CID 56796751
(Z)-2-(5-chloro-1,3-benzothiazol-2-yl)-5-cyclopropyl-3-oxohex-4-enenitrile (PubChem CID 56796751) has the molecular formula C16H13ClN2OS and a molecular weight of 316.81 g/mol. Its IUPAC name is (Z)-2-(5-chloro-1,3-benzothiazol-2-yl)-5-cyclopropyl-3-oxohex-4-enenitrile.
| Compound Name | (Z)-2-(5-chloro-1,3-benzothiazol-2-yl)-5-cyclopropyl-3-oxohex-4-enenitrile |
|---|---|
| PubChem CID | 56796751 |
| Molecular Formula | C16H13ClN2OS |
| Molecular Weight | 316.81 g/mol |
| Exact Mass | 316.04 |
| IUPAC Name | (Z)-2-(5-chloro-1,3-benzothiazol-2-yl)-5-cyclopropyl-3-oxohex-4-enenitrile |
| SMILES | C/C(=C/C(=O)C(C#N)c1nc2cc(Cl)ccc2s1)C1CC1 |
| InChI | InChI=1S/C16H13ClN2OS/c1-9(10-2-3-10)6-14(20)12(8-18)16-19-13-7-11(17)4-5-15(13)21-16/h4-7,10,12H,2-3H2,1H3/b9-6- |
| InChIKey | ROMMJHYULAOUPS-TWGQIWQCSA-N |
| XLogP | 4.48 |
| TPSA | 53.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.81 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|