C17H12ClNO2S — CID 3405700
1,3-benzothiazol-2-ylmethyl 3-(3-chlorophenyl)prop-2-enoate (PubChem CID 3405700) has the molecular formula C17H12ClNO2S and a molecular weight of 329.81 g/mol. Its IUPAC name is 1,3-benzothiazol-2-ylmethyl 3-(3-chlorophenyl)prop-2-enoate.
| Compound Name | 1,3-benzothiazol-2-ylmethyl 3-(3-chlorophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 3405700 |
| Molecular Formula | C17H12ClNO2S |
| Molecular Weight | 329.81 g/mol |
| Exact Mass | 329.03 |
| IUPAC Name | 1,3-benzothiazol-2-ylmethyl 3-(3-chlorophenyl)prop-2-enoate |
| SMILES | O=C(C=Cc1cccc(Cl)c1)OCc1nc2ccccc2s1 |
| InChI | InChI=1S/C17H12ClNO2S/c18-13-5-3-4-12(10-13)8-9-17(20)21-11-16-19-14-6-1-2-7-15(14)22-16/h1-10H,11H2 |
| InChIKey | MAWZAPRTYZLMRU-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.81 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|