C20H19ClN2OS — CID 8894169
(E)-N-(1,3-benzothiazol-2-yl)-3-(3-chlorophenyl)-N-(2-methylpropyl)prop-2-enamide (PubChem CID 8894169) has the molecular formula C20H19ClN2OS and a molecular weight of 370.91 g/mol. Its IUPAC name is (E)-N-(1,3-benzothiazol-2-yl)-3-(3-chlorophenyl)-N-(2-methylpropyl)prop-2-enamide.
| Compound Name | (E)-N-(1,3-benzothiazol-2-yl)-3-(3-chlorophenyl)-N-(2-methylpropyl)prop-2-enamide |
|---|---|
| PubChem CID | 8894169 |
| Molecular Formula | C20H19ClN2OS |
| Molecular Weight | 370.91 g/mol |
| Exact Mass | 370.09 |
| IUPAC Name | (E)-N-(1,3-benzothiazol-2-yl)-3-(3-chlorophenyl)-N-(2-methylpropyl)prop-2-enamide |
| SMILES | CC(C)CN(C(=O)/C=C/c1cccc(Cl)c1)c1nc2ccccc2s1 |
| InChI | InChI=1S/C20H19ClN2OS/c1-14(2)13-23(20-22-17-8-3-4-9-18(17)25-20)19(24)11-10-15-6-5-7-16(21)12-15/h3-12,14H,13H2,1-2H3/b11-10+ |
| InChIKey | VRTPUNJWQKCVEK-ZHACJKMWSA-N |
| XLogP | 5.65 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.91 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|