C14H9ClN2O2S — CID 8804286
1,3-benzothiazol-2-ylmethyl 4-chloropyridine-2-carboxylate (PubChem CID 8804286) has the molecular formula C14H9ClN2O2S and a molecular weight of 304.76 g/mol. Its IUPAC name is 1,3-benzothiazol-2-ylmethyl 4-chloropyridine-2-carboxylate.
| Compound Name | 1,3-benzothiazol-2-ylmethyl 4-chloropyridine-2-carboxylate |
|---|---|
| PubChem CID | 8804286 |
| Molecular Formula | C14H9ClN2O2S |
| Molecular Weight | 304.76 g/mol |
| Exact Mass | 304.01 |
| IUPAC Name | 1,3-benzothiazol-2-ylmethyl 4-chloropyridine-2-carboxylate |
| SMILES | O=C(OCc1nc2ccccc2s1)c1cc(Cl)ccn1 |
| InChI | InChI=1S/C14H9ClN2O2S/c15-9-5-6-16-11(7-9)14(18)19-8-13-17-10-3-1-2-4-12(10)20-13/h1-7H,8H2 |
| InChIKey | CLRVIXDPGFFYPA-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.76 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |