1,3-benzothiazol-2-ylmethyl 4-chloropyridine-2-carboxylate

C14H9ClN2O2S — CID 8804286

IUPAC1,3-benzothiazol-2-ylmethyl 4-chloropyridine-2-carboxylate
SMILESO=C(OCc1nc2ccccc2s1)c1cc(Cl)ccn1
InChIInChI=1S/C14H9ClN2O2S/c15-9-5-6-16-11(7-9)14(18)19-8-13-17-10-3-1-2-4-12(10)20-13/h1-7H,8H2
InChIKeyCLRVIXDPGFFYPA-UHFFFAOYSA-N
MW304.76 g/mol
LogP3.70
Rot. Bonds3

About 1,3-benzothiazol-2-ylmethyl 4-chloropyridine-2-carboxylate

1,3-benzothiazol-2-ylmethyl 4-chloropyridine-2-carboxylate (PubChem CID 8804286) has the molecular formula C14H9ClN2O2S and a molecular weight of 304.76 g/mol. Its IUPAC name is 1,3-benzothiazol-2-ylmethyl 4-chloropyridine-2-carboxylate.

Molecular Properties

Compound Name1,3-benzothiazol-2-ylmethyl 4-chloropyridine-2-carboxylate
PubChem CID8804286
Molecular FormulaC14H9ClN2O2S
Molecular Weight304.76 g/mol
Exact Mass304.01
IUPAC Name1,3-benzothiazol-2-ylmethyl 4-chloropyridine-2-carboxylate
SMILESO=C(OCc1nc2ccccc2s1)c1cc(Cl)ccn1
InChIInChI=1S/C14H9ClN2O2S/c15-9-5-6-16-11(7-9)14(18)19-8-13-17-10-3-1-2-4-12(10)20-13/h1-7H,8H2
InChIKeyCLRVIXDPGFFYPA-UHFFFAOYSA-N
XLogP3.70
TPSA52.08 Ų
H-Bond Donors
H-Bond Acceptors5
Rotatable Bonds3
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500304.76
LogP ≤ 53.70
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 105

Analyze 1,3-benzothiazol-2-ylmethyl 4-chloropyridine-2-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1,3-benzothiazol-2-ylmethyl 4-chloropyridine-2-carboxylate?
The IUPAC name of 1,3-benzothiazol-2-ylmethyl 4-chloropyridine-2-carboxylate (CID 8804286) is 1,3-benzothiazol-2-ylmethyl 4-chloropyridine-2-carboxylate.
What is the SMILES notation for 1,3-benzothiazol-2-ylmethyl 4-chloropyridine-2-carboxylate?
The canonical SMILES for 1,3-benzothiazol-2-ylmethyl 4-chloropyridine-2-carboxylate is O=C(OCc1nc2ccccc2s1)c1cc(Cl)ccn1.
What is the InChIKey of 1,3-benzothiazol-2-ylmethyl 4-chloropyridine-2-carboxylate?
The InChIKey is CLRVIXDPGFFYPA-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H9ClN2O2S/c15-9-5-6-16-11(7-9)14(18)19-8-13-17-10-3-1-2-4-12(10)20-13/h1-7H,8H2.
What are the key properties of 1,3-benzothiazol-2-ylmethyl 4-chloropyridine-2-carboxylate?
1,3-benzothiazol-2-ylmethyl 4-chloropyridine-2-carboxylate has a molecular weight of 304.76 g/mol, XLogP of 3.70, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-benzothiazol-2-ylmethyl 4-chloropyridine-2-carboxylate is sourced from PubChem (CID 8804286), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).