C15H10N4OS — CID 94817456
(2R)-2-(1,3-benzothiazol-2-yl)-2-cyano-N-pyridin-4-ylacetamide (PubChem CID 94817456) has the molecular formula C15H10N4OS and a molecular weight of 294.34 g/mol. Its IUPAC name is (2R)-2-(1,3-benzothiazol-2-yl)-2-cyano-N-pyridin-4-ylacetamide.
| Compound Name | (2R)-2-(1,3-benzothiazol-2-yl)-2-cyano-N-pyridin-4-ylacetamide |
|---|---|
| PubChem CID | 94817456 |
| Molecular Formula | C15H10N4OS |
| Molecular Weight | 294.34 g/mol |
| Exact Mass | 294.06 |
| IUPAC Name | (2R)-2-(1,3-benzothiazol-2-yl)-2-cyano-N-pyridin-4-ylacetamide |
| SMILES | N#C[C@H](C(=O)Nc1ccncc1)c1nc2ccccc2s1 |
| InChI | InChI=1S/C15H10N4OS/c16-9-11(14(20)18-10-5-7-17-8-6-10)15-19-12-3-1-2-4-13(12)21-15/h1-8,11H,(H,17,18,20)/t11-/m1/s1 |
| InChIKey | GBYGKFVYALZNLA-LLVKDONJSA-N |
| XLogP | 2.94 |
| TPSA | 78.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.34 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |