C13H12N2O3S2 — CID 94199272
(2R)-2-(1,3-benzothiazol-2-yl)-4-ethylsulfonyl-3-oxobutanenitrile (PubChem CID 94199272) has the molecular formula C13H12N2O3S2 and a molecular weight of 308.38 g/mol. Its IUPAC name is (2R)-2-(1,3-benzothiazol-2-yl)-4-ethylsulfonyl-3-oxobutanenitrile.
| Compound Name | (2R)-2-(1,3-benzothiazol-2-yl)-4-ethylsulfonyl-3-oxobutanenitrile |
|---|---|
| PubChem CID | 94199272 |
| Molecular Formula | C13H12N2O3S2 |
| Molecular Weight | 308.38 g/mol |
| Exact Mass | 308.03 |
| IUPAC Name | (2R)-2-(1,3-benzothiazol-2-yl)-4-ethylsulfonyl-3-oxobutanenitrile |
| SMILES | CCS(=O)(=O)CC(=O)[C@@H](C#N)c1nc2ccccc2s1 |
| InChI | InChI=1S/C13H12N2O3S2/c1-2-20(17,18)8-11(16)9(7-14)13-15-10-5-3-4-6-12(10)19-13/h3-6,9H,2,8H2,1H3/t9-/m1/s1 |
| InChIKey | JUMJVPNQOLLRGQ-SECBINFHSA-N |
| XLogP | 1.91 |
| TPSA | 87.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.38 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |