C12H8N4S — CID 7712777
(2S)-2-(1,3-benzothiazol-2-yl)-3-iminopentanedinitrile (PubChem CID 7712777) has the molecular formula C12H8N4S and a molecular weight of 240.29 g/mol. Its IUPAC name is (2S)-2-(1,3-benzothiazol-2-yl)-3-iminopentanedinitrile.
| Compound Name | (2S)-2-(1,3-benzothiazol-2-yl)-3-iminopentanedinitrile |
|---|---|
| PubChem CID | 7712777 |
| Molecular Formula | C12H8N4S |
| Molecular Weight | 240.29 g/mol |
| Exact Mass | 240.05 |
| IUPAC Name | (2S)-2-(1,3-benzothiazol-2-yl)-3-iminopentanedinitrile |
| SMILES | [H]/N=C(\CC#N)[C@@H](C#N)c1nc2ccccc2s1 |
| InChI | InChI=1S/C12H8N4S/c13-6-5-9(15)8(7-14)12-16-10-3-1-2-4-11(10)17-12/h1-4,8,15H,5H2/b15-9+/t8-/m1/s1 |
| InChIKey | DUJSJSJVWVIGDV-CCMDUDBRSA-N |
| XLogP | 2.84 |
| TPSA | 84.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.29 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|