C10H7BrN2S — CID 55162460
2-(1,3-benzothiazol-2-yl)-3-bromopropanenitrile (PubChem CID 55162460) has the molecular formula C10H7BrN2S and a molecular weight of 267.15 g/mol. Its IUPAC name is 2-(1,3-benzothiazol-2-yl)-3-bromopropanenitrile.
| Compound Name | 2-(1,3-benzothiazol-2-yl)-3-bromopropanenitrile |
|---|---|
| PubChem CID | 55162460 |
| Molecular Formula | C10H7BrN2S |
| Molecular Weight | 267.15 g/mol |
| Exact Mass | 265.95 |
| IUPAC Name | 2-(1,3-benzothiazol-2-yl)-3-bromopropanenitrile |
| SMILES | N#CC(CBr)c1nc2ccccc2s1 |
| InChI | InChI=1S/C10H7BrN2S/c11-5-7(6-12)10-13-8-3-1-2-4-9(8)14-10/h1-4,7H,5H2 |
| InChIKey | JMXHCTOFOKBHHL-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 36.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.15 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|