C13H14N2S — CID 114414954
N-[1-(1,3-benzothiazol-2-yl)ethyl]but-3-yn-2-amine (PubChem CID 114414954) has the molecular formula C13H14N2S and a molecular weight of 230.34 g/mol. Its IUPAC name is N-[1-(1,3-benzothiazol-2-yl)ethyl]but-3-yn-2-amine.
| Compound Name | N-[1-(1,3-benzothiazol-2-yl)ethyl]but-3-yn-2-amine |
|---|---|
| PubChem CID | 114414954 |
| Molecular Formula | C13H14N2S |
| Molecular Weight | 230.34 g/mol |
| Exact Mass | 230.09 |
| IUPAC Name | N-[1-(1,3-benzothiazol-2-yl)ethyl]but-3-yn-2-amine |
| SMILES | C#CC(C)NC(C)c1nc2ccccc2s1 |
| InChI | InChI=1S/C13H14N2S/c1-4-9(2)14-10(3)13-15-11-7-5-6-8-12(11)16-13/h1,5-10,14H,2-3H3 |
| InChIKey | WBDBBNLFHKFJCS-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.34 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|