C11H12N2OS — CID 94044935
N-[(1S)-1-(1,3-benzothiazol-2-yl)ethyl]acetamide (PubChem CID 94044935) has the molecular formula C11H12N2OS and a molecular weight of 220.30 g/mol. Its IUPAC name is N-[(1S)-1-(1,3-benzothiazol-2-yl)ethyl]acetamide.
| Compound Name | N-[(1S)-1-(1,3-benzothiazol-2-yl)ethyl]acetamide |
|---|---|
| PubChem CID | 94044935 |
| Molecular Formula | C11H12N2OS |
| Molecular Weight | 220.30 g/mol |
| Exact Mass | 220.07 |
| IUPAC Name | N-[(1S)-1-(1,3-benzothiazol-2-yl)ethyl]acetamide |
| SMILES | CC(=O)N[C@@H](C)c1nc2ccccc2s1 |
| InChI | InChI=1S/C11H12N2OS/c1-7(12-8(2)14)11-13-9-5-3-4-6-10(9)15-11/h3-7H,1-2H3,(H,12,14)/t7-/m0/s1 |
| InChIKey | VWYVPJTYRVPWLY-ZETCQYMHSA-N |
| XLogP | 2.49 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.30 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |