C15H18N2S — CID 114202107
N-[1-(1,3-benzothiazol-2-yl)ethyl]-4-methylpent-1-yn-3-amine (PubChem CID 114202107) has the molecular formula C15H18N2S and a molecular weight of 258.39 g/mol. Its IUPAC name is N-[1-(1,3-benzothiazol-2-yl)ethyl]-4-methylpent-1-yn-3-amine.
| Compound Name | N-[1-(1,3-benzothiazol-2-yl)ethyl]-4-methylpent-1-yn-3-amine |
|---|---|
| PubChem CID | 114202107 |
| Molecular Formula | C15H18N2S |
| Molecular Weight | 258.39 g/mol |
| Exact Mass | 258.12 |
| IUPAC Name | N-[1-(1,3-benzothiazol-2-yl)ethyl]-4-methylpent-1-yn-3-amine |
| SMILES | C#CC(NC(C)c1nc2ccccc2s1)C(C)C |
| InChI | InChI=1S/C15H18N2S/c1-5-12(10(2)3)16-11(4)15-17-13-8-6-7-9-14(13)18-15/h1,6-12,16H,2-4H3 |
| InChIKey | LANMEUMOBRHKPN-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.39 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|