C15H21N3OS — CID 43231791
2-[1-(1,3-benzothiazol-2-yl)ethylamino]-N-propylpropanamide (PubChem CID 43231791) has the molecular formula C15H21N3OS and a molecular weight of 291.42 g/mol. Its IUPAC name is 2-[1-(1,3-benzothiazol-2-yl)ethylamino]-N-propylpropanamide.
| Compound Name | 2-[1-(1,3-benzothiazol-2-yl)ethylamino]-N-propylpropanamide |
|---|---|
| PubChem CID | 43231791 |
| Molecular Formula | C15H21N3OS |
| Molecular Weight | 291.42 g/mol |
| Exact Mass | 291.14 |
| IUPAC Name | 2-[1-(1,3-benzothiazol-2-yl)ethylamino]-N-propylpropanamide |
| SMILES | CCCNC(=O)C(C)NC(C)c1nc2ccccc2s1 |
| InChI | InChI=1S/C15H21N3OS/c1-4-9-16-14(19)10(2)17-11(3)15-18-12-7-5-6-8-13(12)20-15/h5-8,10-11,17H,4,9H2,1-3H3,(H,16,19) |
| InChIKey | PLNVJJLACAPYMY-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.42 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |