C13H9N3OS — CID 100683219
(2R)-2-(1,3-benzothiazol-2-yl)-2-cyano-N-prop-2-ynylacetamide (PubChem CID 100683219) has the molecular formula C13H9N3OS and a molecular weight of 255.30 g/mol. Its IUPAC name is (2R)-2-(1,3-benzothiazol-2-yl)-2-cyano-N-prop-2-ynylacetamide.
| Compound Name | (2R)-2-(1,3-benzothiazol-2-yl)-2-cyano-N-prop-2-ynylacetamide |
|---|---|
| PubChem CID | 100683219 |
| Molecular Formula | C13H9N3OS |
| Molecular Weight | 255.30 g/mol |
| Exact Mass | 255.05 |
| IUPAC Name | (2R)-2-(1,3-benzothiazol-2-yl)-2-cyano-N-prop-2-ynylacetamide |
| SMILES | C#CCNC(=O)[C@@H](C#N)c1nc2ccccc2s1 |
| InChI | InChI=1S/C13H9N3OS/c1-2-7-15-12(17)9(8-14)13-16-10-5-3-4-6-11(10)18-13/h1,3-6,9H,7H2,(H,15,17)/t9-/m1/s1 |
| InChIKey | VCBVUGOYPMMVDN-SECBINFHSA-N |
| XLogP | 1.65 |
| TPSA | 65.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.30 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|