C15H12N2O2S — CID 87443913
2-(1,3-benzothiazol-2-yl)-N-hydroxy-2-phenylacetamide (PubChem CID 87443913) has the molecular formula C15H12N2O2S and a molecular weight of 284.34 g/mol. Its IUPAC name is 2-(1,3-benzothiazol-2-yl)-N-hydroxy-2-phenylacetamide.
| Compound Name | 2-(1,3-benzothiazol-2-yl)-N-hydroxy-2-phenylacetamide |
|---|---|
| PubChem CID | 87443913 |
| Molecular Formula | C15H12N2O2S |
| Molecular Weight | 284.34 g/mol |
| Exact Mass | 284.06 |
| IUPAC Name | 2-(1,3-benzothiazol-2-yl)-N-hydroxy-2-phenylacetamide |
| SMILES | O=C(NO)C(c1ccccc1)c1nc2ccccc2s1 |
| InChI | InChI=1S/C15H12N2O2S/c18-14(17-19)13(10-6-2-1-3-7-10)15-16-11-8-4-5-9-12(11)20-15/h1-9,13,19H,(H,17,18) |
| InChIKey | NVESWVXYZXBFLG-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.34 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|