C17H14N4O7S4 — CID 174961880
1,3-benzothiazol-2-yl-[[1,3-benzothiazol-2-yl(sulfo)methyl]carbamoylamino]methanesulfonic acid (PubChem CID 174961880) has the molecular formula C17H14N4O7S4 and a molecular weight of 514.59 g/mol. Its IUPAC name is 1,3-benzothiazol-2-yl-[[1,3-benzothiazol-2-yl(sulfo)methyl]carbamoylamino]methanesulfonic acid.
| Compound Name | 1,3-benzothiazol-2-yl-[[1,3-benzothiazol-2-yl(sulfo)methyl]carbamoylamino]methanesulfonic acid |
|---|---|
| PubChem CID | 174961880 |
| Molecular Formula | C17H14N4O7S4 |
| Molecular Weight | 514.59 g/mol |
| Exact Mass | 513.97 |
| IUPAC Name | 1,3-benzothiazol-2-yl-[[1,3-benzothiazol-2-yl(sulfo)methyl]carbamoylamino]methanesulfonic acid |
| SMILES | O=C(NC(c1nc2ccccc2s1)S(=O)(=O)O)NC(c1nc2ccccc2s1)S(=O)(=O)O |
| InChI | InChI=1S/C17H14N4O7S4/c22-17(20-15(31(23,24)25)13-18-9-5-1-3-7-11(9)29-13)21-16(32(26,27)28)14-19-10-6-2-4-8-12(10)30-14/h1-8,15-16H,(H2,20,21,22)(H,23,24,25)(H,26,27,28) |
| InChIKey | PKBNTIDEQSVKRE-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 175.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.59 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|