C25H18N2O3S2 — CID 101193863
3-[2-[2,2-bis(1,3-benzothiazol-2-yl)ethyl]phenyl]-3-oxopropanoic acid (PubChem CID 101193863) has the molecular formula C25H18N2O3S2 and a molecular weight of 458.56 g/mol. Its IUPAC name is 3-[2-[2,2-bis(1,3-benzothiazol-2-yl)ethyl]phenyl]-3-oxopropanoic acid.
| Compound Name | 3-[2-[2,2-bis(1,3-benzothiazol-2-yl)ethyl]phenyl]-3-oxopropanoic acid |
|---|---|
| PubChem CID | 101193863 |
| Molecular Formula | C25H18N2O3S2 |
| Molecular Weight | 458.56 g/mol |
| Exact Mass | 458.08 |
| IUPAC Name | 3-[2-[2,2-bis(1,3-benzothiazol-2-yl)ethyl]phenyl]-3-oxopropanoic acid |
| SMILES | O=C(O)CC(=O)c1ccccc1CC(c1nc2ccccc2s1)c1nc2ccccc2s1 |
| InChI | InChI=1S/C25H18N2O3S2/c28-20(14-23(29)30)16-8-2-1-7-15(16)13-17(24-26-18-9-3-5-11-21(18)31-24)25-27-19-10-4-6-12-22(19)32-25/h1-12,17H,13-14H2,(H,29,30) |
| InChIKey | WJIUUDIPPINACR-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 80.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.56 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|