C17H19NOSSi — CID 13485204
[1,3-benzothiazol-2-yl(phenyl)methoxy]-trimethylsilane (PubChem CID 13485204) has the molecular formula C17H19NOSSi and a molecular weight of 313.50 g/mol. Its IUPAC name is [1,3-benzothiazol-2-yl(phenyl)methoxy]-trimethylsilane.
| Compound Name | [1,3-benzothiazol-2-yl(phenyl)methoxy]-trimethylsilane |
|---|---|
| PubChem CID | 13485204 |
| Molecular Formula | C17H19NOSSi |
| Molecular Weight | 313.50 g/mol |
| Exact Mass | 313.10 |
| IUPAC Name | [1,3-benzothiazol-2-yl(phenyl)methoxy]-trimethylsilane |
| SMILES | C[Si](C)(C)OC(c1ccccc1)c1nc2ccccc2s1 |
| InChI | InChI=1S/C17H19NOSSi/c1-21(2,3)19-16(13-9-5-4-6-10-13)17-18-14-11-7-8-12-15(14)20-17/h4-12,16H,1-3H3 |
| InChIKey | PELDVIYHPNLNAU-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.50 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|