C20H20N2S4 — CID 139653481
2-[1-[2-(1,3-benzothiazol-2-yl)propyldisulfanyl]propan-2-yl]-1,3-benzothiazole (PubChem CID 139653481) has the molecular formula C20H20N2S4 and a molecular weight of 416.66 g/mol. Its IUPAC name is 2-[1-[2-(1,3-benzothiazol-2-yl)propyldisulfanyl]propan-2-yl]-1,3-benzothiazole.
| Compound Name | 2-[1-[2-(1,3-benzothiazol-2-yl)propyldisulfanyl]propan-2-yl]-1,3-benzothiazole |
|---|---|
| PubChem CID | 139653481 |
| Molecular Formula | C20H20N2S4 |
| Molecular Weight | 416.66 g/mol |
| Exact Mass | 416.05 |
| IUPAC Name | 2-[1-[2-(1,3-benzothiazol-2-yl)propyldisulfanyl]propan-2-yl]-1,3-benzothiazole |
| SMILES | CC(CSSCC(C)c1nc2ccccc2s1)c1nc2ccccc2s1 |
| InChI | InChI=1S/C20H20N2S4/c1-13(19-21-15-7-3-5-9-17(15)25-19)11-23-24-12-14(2)20-22-16-8-4-6-10-18(16)26-20/h3-10,13-14H,11-12H2,1-2H3 |
| InChIKey | HRWVFGMTRGXPAH-UHFFFAOYSA-N |
| XLogP | 7.19 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.66 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|