C19H15N3OS — CID 97070615
(2S)-2-cyano-2-[4-(4-methylphenyl)-1,3-thiazol-2-yl]-N-phenylacetamide (PubChem CID 97070615) has the molecular formula C19H15N3OS and a molecular weight of 333.42 g/mol. Its IUPAC name is (2S)-2-cyano-2-[4-(4-methylphenyl)-1,3-thiazol-2-yl]-N-phenylacetamide.
| Compound Name | (2S)-2-cyano-2-[4-(4-methylphenyl)-1,3-thiazol-2-yl]-N-phenylacetamide |
|---|---|
| PubChem CID | 97070615 |
| Molecular Formula | C19H15N3OS |
| Molecular Weight | 333.42 g/mol |
| Exact Mass | 333.09 |
| IUPAC Name | (2S)-2-cyano-2-[4-(4-methylphenyl)-1,3-thiazol-2-yl]-N-phenylacetamide |
| SMILES | Cc1ccc(-c2csc([C@@H](C#N)C(=O)Nc3ccccc3)n2)cc1 |
| InChI | InChI=1S/C19H15N3OS/c1-13-7-9-14(10-8-13)17-12-24-19(22-17)16(11-20)18(23)21-15-5-3-2-4-6-15/h2-10,12,16H,1H3,(H,21,23)/t16-/m0/s1 |
| InChIKey | QFEZGRXHDYIHIH-INIZCTEOSA-N |
| XLogP | 4.36 |
| TPSA | 65.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.42 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |