C23H18N4OS — CID 57004238
N-phenyl-2-phenyldiazenyl-2-(4-phenyl-1,3-thiazol-2-yl)acetamide (PubChem CID 57004238) has the molecular formula C23H18N4OS and a molecular weight of 398.49 g/mol. Its IUPAC name is N-phenyl-2-phenyldiazenyl-2-(4-phenyl-1,3-thiazol-2-yl)acetamide.
| Compound Name | N-phenyl-2-phenyldiazenyl-2-(4-phenyl-1,3-thiazol-2-yl)acetamide |
|---|---|
| PubChem CID | 57004238 |
| Molecular Formula | C23H18N4OS |
| Molecular Weight | 398.49 g/mol |
| Exact Mass | 398.12 |
| IUPAC Name | N-phenyl-2-phenyldiazenyl-2-(4-phenyl-1,3-thiazol-2-yl)acetamide |
| SMILES | O=C(Nc1ccccc1)C(/N=N/c1ccccc1)c1nc(-c2ccccc2)cs1 |
| InChI | InChI=1S/C23H18N4OS/c28-22(24-18-12-6-2-7-13-18)21(27-26-19-14-8-3-9-15-19)23-25-20(16-29-23)17-10-4-1-5-11-17/h1-16,21H,(H,24,28)/b27-26+ |
| InChIKey | HICWFZBJDXABPH-CYYJNZCTSA-N |
| XLogP | 6.27 |
| TPSA | 66.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.49 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|