C23H17N5OS — CID 3724946
2-(benzotriazol-1-yl)-N-phenyl-2-(4-phenyl-1,3-thiazol-2-yl)acetamide (PubChem CID 3724946) has the molecular formula C23H17N5OS and a molecular weight of 411.49 g/mol. Its IUPAC name is 2-(benzotriazol-1-yl)-N-phenyl-2-(4-phenyl-1,3-thiazol-2-yl)acetamide.
| Compound Name | 2-(benzotriazol-1-yl)-N-phenyl-2-(4-phenyl-1,3-thiazol-2-yl)acetamide |
|---|---|
| PubChem CID | 3724946 |
| Molecular Formula | C23H17N5OS |
| Molecular Weight | 411.49 g/mol |
| Exact Mass | 411.12 |
| IUPAC Name | 2-(benzotriazol-1-yl)-N-phenyl-2-(4-phenyl-1,3-thiazol-2-yl)acetamide |
| SMILES | O=C(Nc1ccccc1)C(c1nc(-c2ccccc2)cs1)n1nnc2ccccc21 |
| InChI | InChI=1S/C23H17N5OS/c29-22(24-17-11-5-2-6-12-17)21(28-20-14-8-7-13-18(20)26-27-28)23-25-19(15-30-23)16-9-3-1-4-10-16/h1-15,21H,(H,24,29) |
| InChIKey | UAVSUJIWVOKQDO-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.49 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |