C19H22N4O2S — CID 139067782
(2R)-2-(benzotriazol-1-yl)-4,4-dimethyl-3-oxo-N-phenylpentanethioamide;hydrate (PubChem CID 139067782) has the molecular formula C19H22N4O2S and a molecular weight of 370.48 g/mol. Its IUPAC name is (2R)-2-(benzotriazol-1-yl)-4,4-dimethyl-3-oxo-N-phenylpentanethioamide;hydrate.
| Compound Name | (2R)-2-(benzotriazol-1-yl)-4,4-dimethyl-3-oxo-N-phenylpentanethioamide;hydrate |
|---|---|
| PubChem CID | 139067782 |
| Molecular Formula | C19H22N4O2S |
| Molecular Weight | 370.48 g/mol |
| Exact Mass | 370.15 |
| IUPAC Name | (2R)-2-(benzotriazol-1-yl)-4,4-dimethyl-3-oxo-N-phenylpentanethioamide;hydrate |
| SMILES | CC(C)(C)C(=O)[C@H](C(=S)Nc1ccccc1)n1nnc2ccccc21.O |
| InChI | InChI=1S/C19H20N4OS.H2O/c1-19(2,3)17(24)16(18(25)20-13-9-5-4-6-10-13)23-15-12-8-7-11-14(15)21-22-23;/h4-12,16H,1-3H3,(H,20,25);1H2/t16-;/m1./s1 |
| InChIKey | REQMBTKSSIZZKM-PKLMIRHRSA-N |
| XLogP | 3.20 |
| TPSA | 91.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.48 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|