C15H14N6OS — CID 848903
1-[[2-(benzotriazol-1-yl)acetyl]amino]-3-phenylthiourea (PubChem CID 848903) has the molecular formula C15H14N6OS and a molecular weight of 326.39 g/mol. Its IUPAC name is 1-[[2-(benzotriazol-1-yl)acetyl]amino]-3-phenylthiourea.
| Compound Name | 1-[[2-(benzotriazol-1-yl)acetyl]amino]-3-phenylthiourea |
|---|---|
| PubChem CID | 848903 |
| Molecular Formula | C15H14N6OS |
| Molecular Weight | 326.39 g/mol |
| Exact Mass | 326.09 |
| IUPAC Name | 1-[[2-(benzotriazol-1-yl)acetyl]amino]-3-phenylthiourea |
| SMILES | O=C(Cn1nnc2ccccc21)NNC(=S)Nc1ccccc1 |
| InChI | InChI=1S/C15H14N6OS/c22-14(10-21-13-9-5-4-8-12(13)17-20-21)18-19-15(23)16-11-6-2-1-3-7-11/h1-9H,10H2,(H,18,22)(H2,16,19,23) |
| InChIKey | IFICMEPIGRMJNE-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 83.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.39 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|