C16H14F2N6OS2 — CID 8618042
1-[[2-(benzotriazol-1-yl)acetyl]amino]-3-[4-(difluoromethylsulfanyl)phenyl]thiourea (PubChem CID 8618042) has the molecular formula C16H14F2N6OS2 and a molecular weight of 408.46 g/mol. Its IUPAC name is 1-[[2-(benzotriazol-1-yl)acetyl]amino]-3-[4-(difluoromethylsulfanyl)phenyl]thiourea.
| Compound Name | 1-[[2-(benzotriazol-1-yl)acetyl]amino]-3-[4-(difluoromethylsulfanyl)phenyl]thiourea |
|---|---|
| PubChem CID | 8618042 |
| Molecular Formula | C16H14F2N6OS2 |
| Molecular Weight | 408.46 g/mol |
| Exact Mass | 408.06 |
| IUPAC Name | 1-[[2-(benzotriazol-1-yl)acetyl]amino]-3-[4-(difluoromethylsulfanyl)phenyl]thiourea |
| SMILES | O=C(Cn1nnc2ccccc21)NNC(=S)Nc1ccc(SC(F)F)cc1 |
| InChI | InChI=1S/C16H14F2N6OS2/c17-15(18)27-11-7-5-10(6-8-11)19-16(26)22-21-14(25)9-24-13-4-2-1-3-12(13)20-23-24/h1-8,15H,9H2,(H,21,25)(H2,19,22,26) |
| InChIKey | CBBXDBYAJMBSEH-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 83.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.46 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|