C16H14F2N4OS — CID 26499294
N-[4-(difluoromethylsulfanyl)phenyl]-1-ethylbenzotriazole-5-carboxamide (PubChem CID 26499294) has the molecular formula C16H14F2N4OS and a molecular weight of 348.38 g/mol. Its IUPAC name is N-[4-(difluoromethylsulfanyl)phenyl]-1-ethylbenzotriazole-5-carboxamide.
| Compound Name | N-[4-(difluoromethylsulfanyl)phenyl]-1-ethylbenzotriazole-5-carboxamide |
|---|---|
| PubChem CID | 26499294 |
| Molecular Formula | C16H14F2N4OS |
| Molecular Weight | 348.38 g/mol |
| Exact Mass | 348.09 |
| IUPAC Name | N-[4-(difluoromethylsulfanyl)phenyl]-1-ethylbenzotriazole-5-carboxamide |
| SMILES | CCn1nnc2cc(C(=O)Nc3ccc(SC(F)F)cc3)ccc21 |
| InChI | InChI=1S/C16H14F2N4OS/c1-2-22-14-8-3-10(9-13(14)20-21-22)15(23)19-11-4-6-12(7-5-11)24-16(17)18/h3-9,16H,2H2,1H3,(H,19,23) |
| InChIKey | NZQJRWKBRRISKT-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.38 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |