C36H38N3O4P — CID 100975028
ditert-butyl 2-(benzotriazol-1-yl)-3-(triphenyl-λ5-phosphanylidene)butanedioate (PubChem CID 100975028) has the molecular formula C36H38N3O4P and a molecular weight of 607.69 g/mol. Its IUPAC name is ditert-butyl 2-(benzotriazol-1-yl)-3-(triphenyl-λ5-phosphanylidene)butanedioate.
| Compound Name | ditert-butyl 2-(benzotriazol-1-yl)-3-(triphenyl-λ5-phosphanylidene)butanedioate |
|---|---|
| PubChem CID | 100975028 |
| Molecular Formula | C36H38N3O4P |
| Molecular Weight | 607.69 g/mol |
| Exact Mass | 607.26 |
| IUPAC Name | ditert-butyl 2-(benzotriazol-1-yl)-3-(triphenyl-λ5-phosphanylidene)butanedioate |
| SMILES | CC(C)(C)OC(=O)C(C(C(=O)OC(C)(C)C)n1nnc2ccccc21)=P(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C36H38N3O4P/c1-35(2,3)42-33(40)31(39-30-25-17-16-24-29(30)37-38-39)32(34(41)43-36(4,5)6)44(26-18-10-7-11-19-26,27-20-12-8-13-21-27)28-22-14-9-15-23-28/h7-25,31H,1-6H3 |
| InChIKey | CBIDQIKCDBSDIU-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 83.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.69 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|