About 2-amino-2-methylpropanamide;1-hydroxybenzotriazole
2-amino-2-methylpropanamide;1-hydroxybenzotriazole (PubChem CID 160606346) has the molecular formula C10H15N5O2
and a molecular weight of 237.26 g/mol. Its IUPAC name is 2-amino-2-methylpropanamide;1-hydroxybenzotriazole.
Molecular Properties
| Compound Name | 2-amino-2-methylpropanamide;1-hydroxybenzotriazole |
| PubChem CID | 160606346 |
| Molecular Formula | C10H15N5O2 |
| Molecular Weight | 237.26 g/mol |
| Exact Mass | 237.12 |
| IUPAC Name | 2-amino-2-methylpropanamide;1-hydroxybenzotriazole |
| SMILES | CC(C)(N)C(N)=O.On1nnc2ccccc21 |
| InChI | InChI=1S/C6H5N3O.C4H10N2O/c10-9-6-4-2-1-3-5(6)7-8-9;1-4(2,6)3(5)7/h1-4,10H;6H2,1-2H3,(H2,5,7) |
| InChIKey | REXMNIMCIOGALA-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 120.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.26 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 2-amino-2-methylpropanamide;1-hydroxybenzotriazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-2-methylpropanamide;1-hydroxybenzotriazole?
The IUPAC name of 2-amino-2-methylpropanamide;1-hydroxybenzotriazole (CID 160606346) is 2-amino-2-methylpropanamide;1-hydroxybenzotriazole.
What is the SMILES notation for 2-amino-2-methylpropanamide;1-hydroxybenzotriazole?
The canonical SMILES for 2-amino-2-methylpropanamide;1-hydroxybenzotriazole is CC(C)(N)C(N)=O.On1nnc2ccccc21.
What is the InChIKey of 2-amino-2-methylpropanamide;1-hydroxybenzotriazole?
The InChIKey is REXMNIMCIOGALA-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5N3O.C4H10N2O/c10-9-6-4-2-1-3-5(6)7-8-9;1-4(2,6)3(5)7/h1-4,10H;6H2,1-2H3,(H2,5,7).
What are the key properties of 2-amino-2-methylpropanamide;1-hydroxybenzotriazole?
2-amino-2-methylpropanamide;1-hydroxybenzotriazole has a molecular weight of 237.26 g/mol, XLogP of -0.12, 1 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-2-methylpropanamide;1-hydroxybenzotriazole is sourced from PubChem (CID 160606346), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).