C22H38N4O4 — CID 67598718
N,N-bis(2-hydroxyethyl)dodecanamide;1-hydroxybenzotriazole (PubChem CID 67598718) has the molecular formula C22H38N4O4 and a molecular weight of 422.57 g/mol. Its IUPAC name is N,N-bis(2-hydroxyethyl)dodecanamide;1-hydroxybenzotriazole.
| Compound Name | N,N-bis(2-hydroxyethyl)dodecanamide;1-hydroxybenzotriazole |
|---|---|
| PubChem CID | 67598718 |
| Molecular Formula | C22H38N4O4 |
| Molecular Weight | 422.57 g/mol |
| Exact Mass | 422.29 |
| IUPAC Name | N,N-bis(2-hydroxyethyl)dodecanamide;1-hydroxybenzotriazole |
| SMILES | CCCCCCCCCCCC(=O)N(CCO)CCO.On1nnc2ccccc21 |
| InChI | InChI=1S/C16H33NO3.C6H5N3O/c1-2-3-4-5-6-7-8-9-10-11-16(20)17(12-14-18)13-15-19;10-9-6-4-2-1-3-5(6)7-8-9/h18-19H,2-15H2,1H3;1-4,10H |
| InChIKey | DYEMHAZLVHCHAJ-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 111.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.57 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'} |
|---|