C20H44N2O5 — CID 56843583
N,N-bis(2-hydroxyethyl)dodecanamide;2-(2-hydroxyethylamino)ethanol (PubChem CID 56843583) has the molecular formula C20H44N2O5 and a molecular weight of 392.58 g/mol. Its IUPAC name is N,N-bis(2-hydroxyethyl)dodecanamide;2-(2-hydroxyethylamino)ethanol.
| Compound Name | N,N-bis(2-hydroxyethyl)dodecanamide;2-(2-hydroxyethylamino)ethanol |
|---|---|
| PubChem CID | 56843583 |
| Molecular Formula | C20H44N2O5 |
| Molecular Weight | 392.58 g/mol |
| Exact Mass | 392.33 |
| IUPAC Name | N,N-bis(2-hydroxyethyl)dodecanamide;2-(2-hydroxyethylamino)ethanol |
| SMILES | CCCCCCCCCCCC(=O)N(CCO)CCO.OCCNCCO |
| InChI | InChI=1S/C16H33NO3.C4H11NO2/c1-2-3-4-5-6-7-8-9-10-11-16(20)17(12-14-18)13-15-19;6-3-1-5-2-4-7/h18-19H,2-15H2,1H3;5-7H,1-4H2 |
| InChIKey | RNSLNPFABABULE-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 113.26 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.58 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|