About 4-[[4-(dioctylamino)-4-oxobutyl]amino]-N,N-dioctylbutanamide
4-[[4-(dioctylamino)-4-oxobutyl]amino]-N,N-dioctylbutanamide (PubChem CID 164875605) has the molecular formula C40H81N3O2
and a molecular weight of 636.11 g/mol. Its IUPAC name is 4-[[4-(dioctylamino)-4-oxobutyl]amino]-N,N-dioctylbutanamide.
Molecular Properties
| Compound Name | 4-[[4-(dioctylamino)-4-oxobutyl]amino]-N,N-dioctylbutanamide |
| PubChem CID | 164875605 |
| Molecular Formula | C40H81N3O2 |
| Molecular Weight | 636.11 g/mol |
| Exact Mass | 635.63 |
| IUPAC Name | 4-[[4-(dioctylamino)-4-oxobutyl]amino]-N,N-dioctylbutanamide |
| SMILES | CCCCCCCCN(CCCCCCCC)C(=O)CCCNCCCC(=O)N(CCCCCCCC)CCCCCCCC |
| InChI | InChI=1S/C40H81N3O2/c1-5-9-13-17-21-25-35-42(36-26-22-18-14-10-6-2)39(44)31-29-33-41-34-30-32-40(45)43(37-27-23-19-15-11-7-3)38-28-24-20-16-12-8-4/h41H,5-38H2,1-4H3 |
| InChIKey | KZVFSSLKEXEIDA-UHFFFAOYSA-N |
| XLogP | 11.24 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 36 |
| Heavy Atoms | 45 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 636.11 |
| LogP ≤ 5 | 11.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-[[4-(dioctylamino)-4-oxobutyl]amino]-N,N-dioctylbutanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[4-(dioctylamino)-4-oxobutyl]amino]-N,N-dioctylbutanamide?
The IUPAC name of 4-[[4-(dioctylamino)-4-oxobutyl]amino]-N,N-dioctylbutanamide (CID 164875605) is 4-[[4-(dioctylamino)-4-oxobutyl]amino]-N,N-dioctylbutanamide.
What is the SMILES notation for 4-[[4-(dioctylamino)-4-oxobutyl]amino]-N,N-dioctylbutanamide?
The canonical SMILES for 4-[[4-(dioctylamino)-4-oxobutyl]amino]-N,N-dioctylbutanamide is CCCCCCCCN(CCCCCCCC)C(=O)CCCNCCCC(=O)N(CCCCCCCC)CCCCCCCC.
What is the InChIKey of 4-[[4-(dioctylamino)-4-oxobutyl]amino]-N,N-dioctylbutanamide?
The InChIKey is KZVFSSLKEXEIDA-UHFFFAOYSA-N. The full InChI is InChI=1S/C40H81N3O2/c1-5-9-13-17-21-25-35-42(36-26-22-18-14-10-6-2)39(44)31-29-33-41-34-30-32-40(45)43(37-27-23-19-15-11-7-3)38-28-24-20-16-12-8-4/h41H,5-38H2,1-4H3.
What are the key properties of 4-[[4-(dioctylamino)-4-oxobutyl]amino]-N,N-dioctylbutanamide?
4-[[4-(dioctylamino)-4-oxobutyl]amino]-N,N-dioctylbutanamide has a molecular weight of 636.11 g/mol, XLogP of 11.24, 36 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[4-(dioctylamino)-4-oxobutyl]amino]-N,N-dioctylbutanamide is sourced from PubChem (CID 164875605), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).