About acetic acid;1-octylbenzotriazole
acetic acid;1-octylbenzotriazole (PubChem CID 175150004) has the molecular formula C16H25N3O2
and a molecular weight of 291.39 g/mol. Its IUPAC name is acetic acid;1-octylbenzotriazole.
Molecular Properties
| Compound Name | acetic acid;1-octylbenzotriazole |
| PubChem CID | 175150004 |
| Molecular Formula | C16H25N3O2 |
| Molecular Weight | 291.39 g/mol |
| Exact Mass | 291.19 |
| IUPAC Name | acetic acid;1-octylbenzotriazole |
| SMILES | CC(=O)O.CCCCCCCCn1nnc2ccccc21 |
| InChI | InChI=1S/C14H21N3.C2H4O2/c1-2-3-4-5-6-9-12-17-14-11-8-7-10-13(14)15-16-17;1-2(3)4/h7-8,10-11H,2-6,9,12H2,1H3;1H3,(H,3,4) |
| InChIKey | ACSIOHKFOUEJKC-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.39 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze acetic acid;1-octylbenzotriazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetic acid;1-octylbenzotriazole?
The IUPAC name of acetic acid;1-octylbenzotriazole (CID 175150004) is acetic acid;1-octylbenzotriazole.
What is the SMILES notation for acetic acid;1-octylbenzotriazole?
The canonical SMILES for acetic acid;1-octylbenzotriazole is CC(=O)O.CCCCCCCCn1nnc2ccccc21.
What is the InChIKey of acetic acid;1-octylbenzotriazole?
The InChIKey is ACSIOHKFOUEJKC-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H21N3.C2H4O2/c1-2-3-4-5-6-9-12-17-14-11-8-7-10-13(14)15-16-17;1-2(3)4/h7-8,10-11H,2-6,9,12H2,1H3;1H3,(H,3,4).
What are the key properties of acetic acid;1-octylbenzotriazole?
acetic acid;1-octylbenzotriazole has a molecular weight of 291.39 g/mol, XLogP of 3.88, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for acetic acid;1-octylbenzotriazole is sourced from PubChem (CID 175150004), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).