About 1-tridecylbenzotriazole
1-tridecylbenzotriazole (PubChem CID 21059042) has the molecular formula C19H31N3
and a molecular weight of 301.48 g/mol. Its IUPAC name is 1-tridecylbenzotriazole.
Molecular Properties
| Compound Name | 1-tridecylbenzotriazole |
| PubChem CID | 21059042 |
| Molecular Formula | C19H31N3 |
| Molecular Weight | 301.48 g/mol |
| Exact Mass | 301.25 |
| IUPAC Name | 1-tridecylbenzotriazole |
| SMILES | CCCCCCCCCCCCCn1nnc2ccccc21 |
| InChI | InChI=1S/C19H31N3/c1-2-3-4-5-6-7-8-9-10-11-14-17-22-19-16-13-12-15-18(19)20-21-22/h12-13,15-16H,2-11,14,17H2,1H3 |
| InChIKey | HCHOOGLICGXJCC-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 301.48 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-tridecylbenzotriazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-tridecylbenzotriazole?
The IUPAC name of 1-tridecylbenzotriazole (CID 21059042) is 1-tridecylbenzotriazole.
What is the SMILES notation for 1-tridecylbenzotriazole?
The canonical SMILES for 1-tridecylbenzotriazole is CCCCCCCCCCCCCn1nnc2ccccc21.
What is the InChIKey of 1-tridecylbenzotriazole?
The InChIKey is HCHOOGLICGXJCC-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H31N3/c1-2-3-4-5-6-7-8-9-10-11-14-17-22-19-16-13-12-15-18(19)20-21-22/h12-13,15-16H,2-11,14,17H2,1H3.
What are the key properties of 1-tridecylbenzotriazole?
1-tridecylbenzotriazole has a molecular weight of 301.48 g/mol, XLogP of 5.74, 12 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-tridecylbenzotriazole is sourced from PubChem (CID 21059042), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).