About silver 1-octylbenzotriazole
silver 1-octylbenzotriazole (PubChem CID 19818350) has the molecular formula C14H21AgN3+
and a molecular weight of 339.21 g/mol. Its IUPAC name is silver 1-octylbenzotriazole.
Molecular Properties
| Compound Name | silver 1-octylbenzotriazole |
| PubChem CID | 19818350 |
| Molecular Formula | C14H21AgN3+ |
| Molecular Weight | 339.21 g/mol |
| Exact Mass | 338.08 |
| IUPAC Name | silver 1-octylbenzotriazole |
| SMILES | CCCCCCCCn1nnc2ccccc21.[Ag+] |
| InChI | InChI=1S/C14H21N3.Ag/c1-2-3-4-5-6-9-12-17-14-11-8-7-10-13(14)15-16-17;/h7-8,10-11H,2-6,9,12H2,1H3;/q;+1 |
| InChIKey | LYPHMLUUYLTQIF-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 339.21 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze silver 1-octylbenzotriazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of silver 1-octylbenzotriazole?
The IUPAC name of silver 1-octylbenzotriazole (CID 19818350) is silver 1-octylbenzotriazole.
What is the SMILES notation for silver 1-octylbenzotriazole?
The canonical SMILES for silver 1-octylbenzotriazole is CCCCCCCCn1nnc2ccccc21.[Ag+].
What is the InChIKey of silver 1-octylbenzotriazole?
The InChIKey is LYPHMLUUYLTQIF-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H21N3.Ag/c1-2-3-4-5-6-9-12-17-14-11-8-7-10-13(14)15-16-17;/h7-8,10-11H,2-6,9,12H2,1H3;/q;+1.
What are the key properties of silver 1-octylbenzotriazole?
silver 1-octylbenzotriazole has a molecular weight of 339.21 g/mol, XLogP of 3.79, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for silver 1-octylbenzotriazole is sourced from PubChem (CID 19818350), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).