About 1-hydroxybenzotriazole;tetrabutylazanium;chloride
1-hydroxybenzotriazole;tetrabutylazanium;chloride (PubChem CID 174721799) has the molecular formula C22H41ClN4O
and a molecular weight of 413.05 g/mol. Its IUPAC name is 1-hydroxybenzotriazole;tetrabutylazanium;chloride.
Molecular Properties
| Compound Name | 1-hydroxybenzotriazole;tetrabutylazanium;chloride |
| PubChem CID | 174721799 |
| Molecular Formula | C22H41ClN4O |
| Molecular Weight | 413.05 g/mol |
| Exact Mass | 412.30 |
| IUPAC Name | 1-hydroxybenzotriazole;tetrabutylazanium;chloride |
| SMILES | CCCC[N+](CCCC)(CCCC)CCCC.On1nnc2ccccc21.[Cl-] |
| InChI | InChI=1S/C16H36N.C6H5N3O.ClH/c1-5-9-13-17(14-10-6-2,15-11-7-3)16-12-8-4;10-9-6-4-2-1-3-5(6)7-8-9;/h5-16H2,1-4H3;1-4,10H;1H/q+1;;/p-1 |
| InChIKey | WSOVKAUJUOVJQI-UHFFFAOYSA-M |
| XLogP | 2.68 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 413.05 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze 1-hydroxybenzotriazole;tetrabutylazanium;chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-hydroxybenzotriazole;tetrabutylazanium;chloride?
The IUPAC name of 1-hydroxybenzotriazole;tetrabutylazanium;chloride (CID 174721799) is 1-hydroxybenzotriazole;tetrabutylazanium;chloride.
What is the SMILES notation for 1-hydroxybenzotriazole;tetrabutylazanium;chloride?
The canonical SMILES for 1-hydroxybenzotriazole;tetrabutylazanium;chloride is CCCC[N+](CCCC)(CCCC)CCCC.On1nnc2ccccc21.[Cl-].
What is the InChIKey of 1-hydroxybenzotriazole;tetrabutylazanium;chloride?
The InChIKey is WSOVKAUJUOVJQI-UHFFFAOYSA-M. The full InChI is InChI=1S/C16H36N.C6H5N3O.ClH/c1-5-9-13-17(14-10-6-2,15-11-7-3)16-12-8-4;10-9-6-4-2-1-3-5(6)7-8-9;/h5-16H2,1-4H3;1-4,10H;1H/q+1;;/p-1.
What are the key properties of 1-hydroxybenzotriazole;tetrabutylazanium;chloride?
1-hydroxybenzotriazole;tetrabutylazanium;chloride has a molecular weight of 413.05 g/mol, XLogP of 2.68, 12 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-hydroxybenzotriazole;tetrabutylazanium;chloride is sourced from PubChem (CID 174721799), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).