About 1-hydroxybenzotriazole;1-hydroxypyridin-2-one
1-hydroxybenzotriazole;1-hydroxypyridin-2-one (PubChem CID 70183009) has the molecular formula C11H10N4O3
and a molecular weight of 246.23 g/mol. Its IUPAC name is 1-hydroxybenzotriazole;1-hydroxypyridin-2-one.
Molecular Properties
| Compound Name | 1-hydroxybenzotriazole;1-hydroxypyridin-2-one |
| PubChem CID | 70183009 |
| Molecular Formula | C11H10N4O3 |
| Molecular Weight | 246.23 g/mol |
| Exact Mass | 246.08 |
| IUPAC Name | 1-hydroxybenzotriazole;1-hydroxypyridin-2-one |
| SMILES | O=c1ccccn1O.On1nnc2ccccc21 |
| InChI | InChI=1S/C6H5N3O.C5H5NO2/c10-9-6-4-2-1-3-5(6)7-8-9;7-5-3-1-2-4-6(5)8/h1-4,10H;1-4,8H |
| InChIKey | YPUKVOIDSIYPAS-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 93.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.23 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 1-hydroxybenzotriazole;1-hydroxypyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-hydroxybenzotriazole;1-hydroxypyridin-2-one?
The IUPAC name of 1-hydroxybenzotriazole;1-hydroxypyridin-2-one (CID 70183009) is 1-hydroxybenzotriazole;1-hydroxypyridin-2-one.
What is the SMILES notation for 1-hydroxybenzotriazole;1-hydroxypyridin-2-one?
The canonical SMILES for 1-hydroxybenzotriazole;1-hydroxypyridin-2-one is O=c1ccccn1O.On1nnc2ccccc21.
What is the InChIKey of 1-hydroxybenzotriazole;1-hydroxypyridin-2-one?
The InChIKey is YPUKVOIDSIYPAS-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5N3O.C5H5NO2/c10-9-6-4-2-1-3-5(6)7-8-9;7-5-3-1-2-4-6(5)8/h1-4,10H;1-4,8H.
What are the key properties of 1-hydroxybenzotriazole;1-hydroxypyridin-2-one?
1-hydroxybenzotriazole;1-hydroxypyridin-2-one has a molecular weight of 246.23 g/mol, XLogP of 0.75, 0 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 1-hydroxybenzotriazole;1-hydroxypyridin-2-one is sourced from PubChem (CID 70183009), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).