About argon;1-hydroxybenzotriazole
argon;1-hydroxybenzotriazole (PubChem CID 87516361) has the molecular formula C6H5ArN3O
and a molecular weight of 175.07 g/mol. Its IUPAC name is argon;1-hydroxybenzotriazole.
Molecular Properties
| Compound Name | argon;1-hydroxybenzotriazole |
| PubChem CID | 87516361 |
| Molecular Formula | C6H5ArN3O |
| Molecular Weight | 175.07 g/mol |
| Exact Mass | 175.01 |
| IUPAC Name | argon;1-hydroxybenzotriazole |
| SMILES | On1nnc2ccccc21.[Ar] |
| InChI | InChI=1S/C6H5N3O.Ar/c10-9-6-4-2-1-3-5(6)7-8-9;/h1-4,10H; |
| InChIKey | AGMVMYGQCFIYAJ-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.07 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'} |
|---|
Analyze argon;1-hydroxybenzotriazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of argon;1-hydroxybenzotriazole?
The IUPAC name of argon;1-hydroxybenzotriazole (CID 87516361) is argon;1-hydroxybenzotriazole.
What is the SMILES notation for argon;1-hydroxybenzotriazole?
The canonical SMILES for argon;1-hydroxybenzotriazole is On1nnc2ccccc21.[Ar].
What is the InChIKey of argon;1-hydroxybenzotriazole?
The InChIKey is AGMVMYGQCFIYAJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5N3O.Ar/c10-9-6-4-2-1-3-5(6)7-8-9;/h1-4,10H;.
What are the key properties of argon;1-hydroxybenzotriazole?
argon;1-hydroxybenzotriazole has a molecular weight of 175.07 g/mol, XLogP of 0.67, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for argon;1-hydroxybenzotriazole is sourced from PubChem (CID 87516361), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).