C20H17N5O5 — CID 174390862
1-(4-ethylphenyl)-3,5-dinitrobenzene;1-hydroxybenzotriazole (PubChem CID 174390862) has the molecular formula C20H17N5O5 and a molecular weight of 407.39 g/mol. Its IUPAC name is 1-(4-ethylphenyl)-3,5-dinitrobenzene;1-hydroxybenzotriazole.
| Compound Name | 1-(4-ethylphenyl)-3,5-dinitrobenzene;1-hydroxybenzotriazole |
|---|---|
| PubChem CID | 174390862 |
| Molecular Formula | C20H17N5O5 |
| Molecular Weight | 407.39 g/mol |
| Exact Mass | 407.12 |
| IUPAC Name | 1-(4-ethylphenyl)-3,5-dinitrobenzene;1-hydroxybenzotriazole |
| SMILES | CCc1ccc(-c2cc([N+](=O)[O-])cc([N+](=O)[O-])c2)cc1.On1nnc2ccccc21 |
| InChI | InChI=1S/C14H12N2O4.C6H5N3O/c1-2-10-3-5-11(6-4-10)12-7-13(15(17)18)9-14(8-12)16(19)20;10-9-6-4-2-1-3-5(6)7-8-9/h3-9H,2H2,1H3;1-4,10H |
| InChIKey | BMJQLMWIKWJDAC-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 137.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.39 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|