About 1-ethyl-4-nitrobenzene;1-phenylethylbenzene
1-ethyl-4-nitrobenzene;1-phenylethylbenzene (PubChem CID 145486394) has the molecular formula C22H23NO2
and a molecular weight of 333.43 g/mol. Its IUPAC name is 1-ethyl-4-nitrobenzene;1-phenylethylbenzene.
Molecular Properties
| Compound Name | 1-ethyl-4-nitrobenzene;1-phenylethylbenzene |
| PubChem CID | 145486394 |
| Molecular Formula | C22H23NO2 |
| Molecular Weight | 333.43 g/mol |
| Exact Mass | 333.17 |
| IUPAC Name | 1-ethyl-4-nitrobenzene;1-phenylethylbenzene |
| SMILES | CC(c1ccccc1)c1ccccc1.CCc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C14H14.C8H9NO2/c1-12(13-8-4-2-5-9-13)14-10-6-3-7-11-14;1-2-7-3-5-8(6-4-7)9(10)11/h2-12H,1H3;3-6H,2H2,1H3 |
| InChIKey | RBIWVYWPBCVNMZ-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 333.43 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-ethyl-4-nitrobenzene;1-phenylethylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethyl-4-nitrobenzene;1-phenylethylbenzene?
The IUPAC name of 1-ethyl-4-nitrobenzene;1-phenylethylbenzene (CID 145486394) is 1-ethyl-4-nitrobenzene;1-phenylethylbenzene.
What is the SMILES notation for 1-ethyl-4-nitrobenzene;1-phenylethylbenzene?
The canonical SMILES for 1-ethyl-4-nitrobenzene;1-phenylethylbenzene is CC(c1ccccc1)c1ccccc1.CCc1ccc([N+](=O)[O-])cc1.
What is the InChIKey of 1-ethyl-4-nitrobenzene;1-phenylethylbenzene?
The InChIKey is RBIWVYWPBCVNMZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14.C8H9NO2/c1-12(13-8-4-2-5-9-13)14-10-6-3-7-11-14;1-2-7-3-5-8(6-4-7)9(10)11/h2-12H,1H3;3-6H,2H2,1H3.
What are the key properties of 1-ethyl-4-nitrobenzene;1-phenylethylbenzene?
1-ethyl-4-nitrobenzene;1-phenylethylbenzene has a molecular weight of 333.43 g/mol, XLogP of 6.00, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethyl-4-nitrobenzene;1-phenylethylbenzene is sourced from PubChem (CID 145486394), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).