About CID 68739763
CID 68739763 (PubChem CID 68739763) has the molecular formula C7H7N3Na
and a molecular weight of 156.14 g/mol.
Molecular Properties
| Compound Name | CID 68739763 |
| PubChem CID | 68739763 |
| Molecular Formula | C7H7N3Na |
| Molecular Weight | 156.14 g/mol |
| Exact Mass | 156.05 |
| IUPAC Name | — |
| SMILES | Cn1nnc2ccccc21.[Na] |
| InChI | InChI=1S/C7H7N3.Na/c1-10-7-5-3-2-4-6(7)8-9-10;/h2-5H,1H3; |
| InChIKey | QDRXZCJMRDEEAE-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.14 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze CID 68739763 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 68739763?
The IUPAC name of CID 68739763 (CID 68739763) is not available.
What is the SMILES notation for CID 68739763?
The canonical SMILES for CID 68739763 is Cn1nnc2ccccc21.[Na].
What is the InChIKey of CID 68739763?
The InChIKey is QDRXZCJMRDEEAE-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7N3.Na/c1-10-7-5-3-2-4-6(7)8-9-10;/h2-5H,1H3;.
What are the key properties of CID 68739763?
CID 68739763 has a molecular weight of 156.14 g/mol, XLogP of 0.59, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 68739763 is sourced from PubChem (CID 68739763), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).