About azanium 1-oxidobenzotriazole
azanium 1-oxidobenzotriazole (PubChem CID 23118068) has the molecular formula C6H8N4O
and a molecular weight of 152.16 g/mol. Its IUPAC name is azanium 1-oxidobenzotriazole.
Molecular Properties
| Compound Name | azanium 1-oxidobenzotriazole |
| PubChem CID | 23118068 |
| Molecular Formula | C6H8N4O |
| Molecular Weight | 152.16 g/mol |
| Exact Mass | 152.07 |
| IUPAC Name | azanium 1-oxidobenzotriazole |
| SMILES | [NH4+].[O-]n1nnc2ccccc21 |
| InChI | InChI=1S/C6H4N3O.H3N/c10-9-6-4-2-1-3-5(6)7-8-9;/h1-4H;1H3/q-1;/p+1 |
| InChIKey | BGEKYIRIBRYUJG-UHFFFAOYSA-O |
| XLogP | 1.15 |
| TPSA | 90.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.16 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'} |
|---|
Analyze azanium 1-oxidobenzotriazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azanium 1-oxidobenzotriazole?
The IUPAC name of azanium 1-oxidobenzotriazole (CID 23118068) is azanium 1-oxidobenzotriazole.
What is the SMILES notation for azanium 1-oxidobenzotriazole?
The canonical SMILES for azanium 1-oxidobenzotriazole is [NH4+].[O-]n1nnc2ccccc21.
What is the InChIKey of azanium 1-oxidobenzotriazole?
The InChIKey is BGEKYIRIBRYUJG-UHFFFAOYSA-O. The full InChI is InChI=1S/C6H4N3O.H3N/c10-9-6-4-2-1-3-5(6)7-8-9;/h1-4H;1H3/q-1;/p+1.
What are the key properties of azanium 1-oxidobenzotriazole?
azanium 1-oxidobenzotriazole has a molecular weight of 152.16 g/mol, XLogP of 1.15, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for azanium 1-oxidobenzotriazole is sourced from PubChem (CID 23118068), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).