About 1-nitrobenzotriazole;silver
1-nitrobenzotriazole;silver (PubChem CID 88789860) has the molecular formula C6H4AgN4O2
and a molecular weight of 271.99 g/mol. Its IUPAC name is 1-nitrobenzotriazole;silver.
Molecular Properties
| Compound Name | 1-nitrobenzotriazole;silver |
| PubChem CID | 88789860 |
| Molecular Formula | C6H4AgN4O2 |
| Molecular Weight | 271.99 g/mol |
| Exact Mass | 270.94 |
| IUPAC Name | 1-nitrobenzotriazole;silver |
| SMILES | O=[N+]([O-])n1nnc2ccccc21.[Ag] |
| InChI | InChI=1S/C6H4N4O2.Ag/c11-10(12)9-6-4-2-1-3-5(6)7-8-9;/h1-4H; |
| InChIKey | TWMPKLSKSNTAMJ-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 73.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.99 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-nitrobenzotriazole;silver with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-nitrobenzotriazole;silver?
The IUPAC name of 1-nitrobenzotriazole;silver (CID 88789860) is 1-nitrobenzotriazole;silver.
What is the SMILES notation for 1-nitrobenzotriazole;silver?
The canonical SMILES for 1-nitrobenzotriazole;silver is O=[N+]([O-])n1nnc2ccccc21.[Ag].
What is the InChIKey of 1-nitrobenzotriazole;silver?
The InChIKey is TWMPKLSKSNTAMJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4N4O2.Ag/c11-10(12)9-6-4-2-1-3-5(6)7-8-9;/h1-4H;.
What are the key properties of 1-nitrobenzotriazole;silver?
1-nitrobenzotriazole;silver has a molecular weight of 271.99 g/mol, XLogP of 0.47, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-nitrobenzotriazole;silver is sourced from PubChem (CID 88789860), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).