About methane;1-methoxybenzotriazole
methane;1-methoxybenzotriazole (PubChem CID 161160564) has the molecular formula C8H11N3O
and a molecular weight of 165.20 g/mol. Its IUPAC name is methane;1-methoxybenzotriazole.
Molecular Properties
| Compound Name | methane;1-methoxybenzotriazole |
| PubChem CID | 161160564 |
| Molecular Formula | C8H11N3O |
| Molecular Weight | 165.20 g/mol |
| Exact Mass | 165.09 |
| IUPAC Name | methane;1-methoxybenzotriazole |
| SMILES | C.COn1nnc2ccccc21 |
| InChI | InChI=1S/C7H7N3O.CH4/c1-11-10-7-5-3-2-4-6(7)8-9-10;/h2-5H,1H3;1H4 |
| InChIKey | UPWBRKNEJIXSNG-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.20 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methane;1-methoxybenzotriazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methane;1-methoxybenzotriazole?
The IUPAC name of methane;1-methoxybenzotriazole (CID 161160564) is methane;1-methoxybenzotriazole.
What is the SMILES notation for methane;1-methoxybenzotriazole?
The canonical SMILES for methane;1-methoxybenzotriazole is C.COn1nnc2ccccc21.
What is the InChIKey of methane;1-methoxybenzotriazole?
The InChIKey is UPWBRKNEJIXSNG-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7N3O.CH4/c1-11-10-7-5-3-2-4-6(7)8-9-10;/h2-5H,1H3;1H4.
What are the key properties of methane;1-methoxybenzotriazole?
methane;1-methoxybenzotriazole has a molecular weight of 165.20 g/mol, XLogP of 1.13, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methane;1-methoxybenzotriazole is sourced from PubChem (CID 161160564), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).