C11H16FN5O — CID 141407796
1-(benzotriazol-1-yloxy)-1-fluoro-N,N,N',N'-tetramethylmethanediamine (PubChem CID 141407796) has the molecular formula C11H16FN5O and a molecular weight of 253.28 g/mol. Its IUPAC name is 1-(benzotriazol-1-yloxy)-1-fluoro-N,N,N',N'-tetramethylmethanediamine.
| Compound Name | 1-(benzotriazol-1-yloxy)-1-fluoro-N,N,N',N'-tetramethylmethanediamine |
|---|---|
| PubChem CID | 141407796 |
| Molecular Formula | C11H16FN5O |
| Molecular Weight | 253.28 g/mol |
| Exact Mass | 253.13 |
| IUPAC Name | 1-(benzotriazol-1-yloxy)-1-fluoro-N,N,N',N'-tetramethylmethanediamine |
| SMILES | CN(C)C(F)(On1nnc2ccccc21)N(C)C |
| InChI | InChI=1S/C11H16FN5O/c1-15(2)11(12,16(3)4)18-17-10-8-6-5-7-9(10)13-14-17/h5-8H,1-4H3 |
| InChIKey | JVIVSLWKDZYVBD-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 46.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.28 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|