C9H6Br2F3N3 — CID 162787629
1-(1,2-dibromo-3,3,3-trifluoropropyl)benzotriazole (PubChem CID 162787629) has the molecular formula C9H6Br2F3N3 and a molecular weight of 372.97 g/mol. Its IUPAC name is 1-(1,2-dibromo-3,3,3-trifluoropropyl)benzotriazole.
| Compound Name | 1-(1,2-dibromo-3,3,3-trifluoropropyl)benzotriazole |
|---|---|
| PubChem CID | 162787629 |
| Molecular Formula | C9H6Br2F3N3 |
| Molecular Weight | 372.97 g/mol |
| Exact Mass | 370.89 |
| IUPAC Name | 1-(1,2-dibromo-3,3,3-trifluoropropyl)benzotriazole |
| SMILES | FC(F)(F)C(Br)C(Br)n1nnc2ccccc21 |
| InChI | InChI=1S/C9H6Br2F3N3/c10-7(9(12,13)14)8(11)17-6-4-2-1-3-5(6)15-16-17/h1-4,7-8H |
| InChIKey | APZIDSIKGDCVJO-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.97 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|